![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Simulations in Physics and Astronomy.url | 2012-11-01 11:48 | 269 | |
| Falstad_Math, Physics, and Engineering Applets.url | 2012-11-01 11:48 | 2.6K | |
| Opal - Wikipedia, the free encyclopedia.url | 2012-11-01 11:46 | 181 | |
| Particle in a one-dimensional lattice (periodic potential) - Wikipedia, the free encyclopedia.url | 2010-10-30 12:05 | 351 | |
| Electronic band structure - Wikipedia.url | 2009-10-31 13:03 | 277 | |
| Condensed Matter Concepts.url | 2008-10-20 23:19 | 143 | |
| Photonic Crystals Tutorial.url | 2007-10-12 15:04 | 131 | |
| Yablonovitch_PBG_JOSAB_1992.url | 2006-11-04 10:53 | 165 | |