![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Photonic Crystals Tutorial.url | 2007-10-12 15:04 | 131 | |
![[ ]](/icons/unknown.gif) | Condensed Matter Concepts.url | 2008-10-20 23:19 | 143 | |
![[ ]](/icons/unknown.gif) | Yablonovitch_PBG_JOSAB_1992.url | 2006-11-04 10:53 | 165 | |
![[ ]](/icons/unknown.gif) | Opal - Wikipedia, the free encyclopedia.url | 2012-11-01 11:46 | 181 | |
![[ ]](/icons/unknown.gif) | Simulations in Physics and Astronomy.url | 2012-11-01 11:48 | 269 | |
![[ ]](/icons/unknown.gif) | Electronic band structure - Wikipedia.url | 2009-10-31 13:03 | 277 | |
![[ ]](/icons/unknown.gif) | Particle in a one-dimensional lattice (periodic potential) - Wikipedia, the free encyclopedia.url | 2010-10-30 12:05 | 351 | |
![[ ]](/icons/unknown.gif) | Falstad_Math, Physics, and Engineering Applets.url | 2012-11-01 11:48 | 2.6K | |
|